N-Boc-PEG12-alcohol structure
|
Common Name | N-Boc-PEG12-alcohol | ||
|---|---|---|---|---|
| CAS Number | 159156-95-3 | Molecular Weight | 645.777 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 672.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C29H59NO14 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 360.5±31.5 °C | |
Use of N-Boc-PEG12-alcoholN-Boc-PEG12-alcohol is a PEG derivative containing a hydroxyl group and Boc-protected amino group. The hydrophilic PEG spacer increases solubility in aqueous media. The hydroxyl group enables further derivatization or replacement with other reactive functional groups. The Boc group can be deprotected under mild acidic conditions to form the free amine. |
| Name | 2-Methyl-2-propanyl (35-hydroxy-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 672.5±55.0 °C at 760 mmHg |
| Molecular Formula | C29H59NO14 |
| Molecular Weight | 645.777 |
| Flash Point | 360.5±31.5 °C |
| Exact Mass | 645.393555 |
| LogP | -3.17 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | PSQUYAYPIOHNGD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Carbamic acid, N-(35-hydroxy-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl (35-hydroxy-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl)carbamate |