N-Boc-PEG7-alcohol structure
|
Common Name | N-Boc-PEG7-alcohol | ||
|---|---|---|---|---|
| CAS Number | 1292268-13-3 | Molecular Weight | 425.514 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 521.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H39NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.0±30.1 °C | |
Use of N-Boc-PEG7-alcoholN-Boc-PEG7-alcohol is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | BocNH-PEG7-OH |
|---|---|
| Synonym | More Synonyms |
| Description | N-Boc-PEG7-alcohol is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 521.1±50.0 °C at 760 mmHg |
| Molecular Formula | C19H39NO9 |
| Molecular Weight | 425.514 |
| Flash Point | 269.0±30.1 °C |
| Exact Mass | 425.262482 |
| LogP | -1.38 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | FOYKHCLPZWXBOB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCO |
| Hazard Codes | Xi |
|---|
| 2-Methyl-2-propanyl (20-hydroxy-3,6,9,12,15,18-hexaoxaicos-1-yl)carbamate |
| Carbamic acid, N-(20-hydroxy-3,6,9,12,15,18-hexaoxaeicos-1-yl)-, 1,1-dimethylethyl ester |
| MFCD29049415 |