N-Boc-PEG6-alcohol structure
|
Common Name | N-Boc-PEG6-alcohol | ||
|---|---|---|---|---|
| CAS Number | 331242-61-6 | Molecular Weight | 381.46200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H35NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-Boc-PEG6-alcoholN-Boc-PEG6-alcohol is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | 2-[2-(2-{2-[2-(2-hydroxyethoxy)ethoxy]ethoxy}ethoxy)ethoxy]ethyl tert-butylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Description | N-Boc-PEG6-alcohol is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
[1]. Nello Mainolfi, wt al. Irak degraders and uses thereof. US20190192668A1. |
| Molecular Formula | C17H35NO8 |
|---|---|
| Molecular Weight | 381.46200 |
| Exact Mass | 381.23600 |
| PSA | 104.71000 |
| LogP | 0.97730 |
| InChIKey | JJZYGSPDXUBTNO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCO |
| Storage condition | -20°C |
| N-(tert-butoxycarbonyl)-17-amino-3,6,9,12,15-pentaoxaheptadecane-1-ol |
| tert-butyl 17-hydroxy-3,6,9,12,15-pentaoxaheptadec-1-ylcarbamate |
| t-butyl 17-hydroxyl-3,6,9,12,15-pentaoxaheptadecylcarbamate |
| 17-t-butyloxycarbonylamino-3,6,9,12,15-pentaoxaheptadecanol |