TCO-PEG4-NHS ester structure
|
Common Name | TCO-PEG4-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1613439-69-2 | Molecular Weight | 514.566 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H38N2O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TCO-PEG4-NHS esterTCO-PEG4-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | TCO-PEG4-NHS ester |
|---|---|
| Synonym | More Synonyms |
| Description | TCO-PEG4-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C24H38N2O10 |
| Molecular Weight | 514.566 |
| Exact Mass | 514.252625 |
| LogP | -0.09 |
| Index of Refraction | 1.525 |
| InChIKey | ZKPMRASGLDBKPF-UPHRSURJSA-N |
| SMILES | O=C(CCOCCOCCOCCOCCNC(=O)OC1CCC=CCCC1)ON1C(=O)CCC1=O |
| Hazard Codes | Xi |
|---|
| (4Z)-4-Cycloocten-1-yl {15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}carbamate |
| Carbamic acid, N-[15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl]-, (4Z)-4-cycloocten-1-yl ester |
| MFCD28118912 |