Bromoacetamido-PEG4-NHS ester structure
|
Common Name | Bromoacetamido-PEG4-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1260139-70-5 | Molecular Weight | 483.308 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H27BrN2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bromoacetamido-PEG4-NHS esterBromoacetamido-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Bromo-N-{15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | Bromoacetamido-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C17H27BrN2O9 |
| Molecular Weight | 483.308 |
| Exact Mass | 482.089996 |
| LogP | -2.83 |
| Index of Refraction | 1.528 |
| InChIKey | BONNYNBXMCRXBJ-UHFFFAOYSA-N |
| SMILES | O=C(CBr)NCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| MFCD20229159 |
| 2-Bromo-N-{15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}acetamide |
| Acetamide, 2-bromo-N-[15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl]- |