m-PEG4-NHS ester structure
|
Common Name | m-PEG4-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 622405-78-1 | Molecular Weight | 333.334 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 431.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C14H23NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.9±31.5 °C | |
Use of m-PEG4-NHS esterm-PEG4-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG4-NHS ester is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.7±55.0 °C at 760 mmHg |
| Molecular Formula | C14H23NO8 |
| Molecular Weight | 333.334 |
| Flash Point | 214.9±31.5 °C |
| Exact Mass | 333.142365 |
| PSA | 100.60000 |
| LogP | -2.87 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | MAYFFZZPEREGBQ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| Storage condition | -20°C |
|
~70%
m-PEG4-NHS ester CAS#:622405-78-1 |
| Literature: BIOCON LIMITED Patent: US2011/118480 A1, 2011 ; Location in patent: Page/Page column 5 ; |
|
~%
m-PEG4-NHS ester CAS#:622405-78-1 |
| Literature: BIOCON LIMITED Patent: US2011/118480 A1, 2011 ; |
|
~%
m-PEG4-NHS ester CAS#:622405-78-1 |
| Literature: BIOCON LIMITED Patent: US2011/118480 A1, 2011 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-Succinimidyl 4,7,10,13-Tetraoxatetradecanoate |
| 1-[(14-Oxo-2,5,8,11-tetraoxatetradecan-14-yl)oxy]-2,5-pyrrolidinedione |
| Methyl-PEG4-NHS Ester |
| 4,7,10,13-Tetraoxatetradecanoic Acid N-Succinimidyl Ester |
| 2,5-Pyrrolidinedione, 1-[(1-oxo-4,7,10,13-tetraoxatetradec-1-yl)oxy]- |
| AmbotzPEG1880 |
| 1-(4,7,10,13-tetraoxatetradecan-1-oyloxy)pyrrolidine-2,5-dione |
| N-hydroxysuccinimidyl 3-{2-[2-(2-methoxy-ethoxy)-ethoxy]-ethoxy}-propanoate |
| M2186 |