PF-06284674 structure
|
Common Name | PF-06284674 | ||
|---|---|---|---|---|
| CAS Number | 1434288-24-0 | Molecular Weight | 290.319 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 499.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C17H14N4O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 255.6±31.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of PF-06284674PF-06284674 is a cell permeable, potent and selective M2 isoform of pyruvate kinase (PKM2) activator. |
| Name | PF-06284674 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 499.1±55.0 °C at 760 mmHg |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.319 |
| Flash Point | 255.6±31.5 °C |
| Exact Mass | 290.116760 |
| LogP | 2.58 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | ICTBPKWPCGSFPZ-UHFFFAOYSA-N |
| SMILES | Cc1cccc2nc(Cn3cnc4ccccc43)cc(=O)n12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P280-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
| RIDADR | NONH for all modes of transport |
| 2-(1H-Benzimidazol-1-ylmethyl)-6-methyl-4H-pyrido[1,2-a]pyrimidin-4-one |
| MFCD29037211 |
| 4H-Pyrido[1,2-a]pyrimidin-4-one, 2-(1H-benzimidazol-1-ylmethyl)-6-methyl- |
| PF-06284674 |