Ac-YVAD-pNA structure
|
Common Name | Ac-YVAD-pNA | ||
|---|---|---|---|---|
| CAS Number | 149231-66-3 | Molecular Weight | 628.63 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1108.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C29H36N6O10 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 624.5±34.3 °C | |
Use of Ac-YVAD-pNAAc-YVAD-pNA is a specific Caspase-1 substrate. Ac-YVAD-pNA can be used to detect Caspase-1 activity. Caspase-1 is a key mediator of inflammatory processes[1][2]. |
| Name | (3S)-3-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]amino]propanoyl]amino]-4-(4-nitroanilino)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Ac-YVAD-pNA is a specific Caspase-1 substrate. Ac-YVAD-pNA can be used to detect Caspase-1 activity. Caspase-1 is a key mediator of inflammatory processes[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Caspase-1 |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1108.9±65.0 °C at 760 mmHg |
| Molecular Formula | C29H36N6O10 |
| Molecular Weight | 628.63 |
| Flash Point | 624.5±34.3 °C |
| Exact Mass | 628.249268 |
| PSA | 248.85000 |
| LogP | 2.61 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | YDPNOCSPPGFBPX-XNHCRPTKSA-N |
| SMILES | CC(=O)NC(Cc1ccc(O)cc1)C(=O)NC(C(=O)NC(C)C(=O)NC(CC(=O)O)C(=O)Nc1ccc([N+](=O)[O-])cc1)C(C)C |
| RIDADR | NONH for all modes of transport |
|---|
| Ac-Tyr-Val-Ala-Asp-PNA |
| IL-1beta Converting Enzyme (ICE) Colorimetric Substrate |
| Ac-Tyr-Val-Ala-Asp-paranitroanilide |
| L-α-Asparagine, N-acetyl-L-tyrosyl-L-valyl-L-alanyl-N-(4-nitrophenyl)- |
| N-Acetyl-L-tyrosyl-L-valyl-L-alanyl-N-(4-nitrophenyl)-L-α-asparagine |
| Caspase-1 Substrate IV,Colorimetric |
| Ac-YVAD-pNA |