nAChR modulator-2 structure
|
Common Name | nAChR modulator-2 | ||
|---|---|---|---|---|
| CAS Number | 1700657-87-9 | Molecular Weight | 261.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of nAChR modulator-2nAChR modulator-2, a insecticide, is a insect nAChR orthosteric modulator[1]. |
| Name | nAChR modulator-2 |
|---|
| Description | nAChR modulator-2, a insecticide, is a insect nAChR orthosteric modulator[1]. |
|---|---|
| Related Catalog | |
| In Vitro | nAChR modulator-2 (compound 2) inhibits three major pests, the larvae of the banded cucumber beetle Diabrotica balteata, the green peach aphid M. persicae, and the cotton leafworm Spodoptera littoralis,with EC90 values of 200 mg/L, 3.12 mg/L, and 200 mg/L[1]. |
| References |
| Molecular Formula | C12H8ClN3O2 |
|---|---|
| Molecular Weight | 261.66 |
| InChIKey | LRTBGGZYKCAJPA-UHFFFAOYSA-N |
| SMILES | [O-]c1n[n+]2c(Cc3ccc(Cl)nc3)cccc2o1 |