Rec 15/2615 dihydrochloride structure
|
Common Name | Rec 15/2615 dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 173059-17-1 | Molecular Weight | 568.49300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H35Cl2N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Rec 15/2615 dihydrochlorideREC-2615 (HCl) is a α1B-adrenoceptor antagonist potentially for the treatment of female sexual dysfunction. |
| Name | Rec 15/2615 dihydrochloride,1-(4-Amino-6,7-dimethoxy-2-quinazolinyl)-4-[[2-methoxy-6-(1-methylethyl)phenoxy]acetyl]piperazinedihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H35Cl2N5O5 |
|---|---|
| Molecular Weight | 568.49300 |
| Exact Mass | 567.20200 |
| PSA | 112.27000 |
| LogP | 5.27690 |
| InChIKey | XZGSTPYGKYGQLD-UHFFFAOYSA-N |
| SMILES | COc1cc2nc(N3CCN(C(=O)COc4c(OC)cccc4C(C)C)CC3)nc(N)c2cc1OC.Cl.Cl |
| Isamoltane hemifumarate |