(24E)-3,7-Dioxolanosta-8,24-dien-26-oic acid structure
|
Common Name | (24E)-3,7-Dioxolanosta-8,24-dien-26-oic acid | ||
|---|---|---|---|---|
| CAS Number | 173075-45-1 | Molecular Weight | 468.668 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 602.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H44O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.0±28.0 °C | |
Use of (24E)-3,7-Dioxolanosta-8,24-dien-26-oic acidGanoderic acid DM, a natural triterpenoid isolated from Ganoderma lucidum, induces DNA damage, G1 cell cycle arrest and apoptosis in human breast cancer cells. Ganoderic acid DM as a specific inhibitor of osteoclastogenesis[1][2]. |
| Name | ganoderic acid dm |
|---|---|
| Synonym | More Synonyms |
| Description | Ganoderic acid DM, a natural triterpenoid isolated from Ganoderma lucidum, induces DNA damage, G1 cell cycle arrest and apoptosis in human breast cancer cells. Ganoderic acid DM as a specific inhibitor of osteoclastogenesis[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Ganoderic acid DM (GADM) effectively inhibits cell proliferation and colony formation in MCF-7 human breast cancer cells, which was much stronger than that of MDA-MB-231 breast cancer cells[1]. Ganoderic acid DM especially suppresses the expression of c-Fos and nuclear factor of activated T cells c1 (NFATc1). Ganoderic acid DM markedly suppressed the expression of cathepsin K and TRAP mRNA[2]. Ganoderic acid DM induces autophagic apoptosis in non-small cell lung cancer cells by inhibiting the PI3K/Akt/mTOR activity[3]. Cell Viability Assay[1] Cell Line: MCF-7 and MDA-MB-231 cells. Concentration: 0-100 μM. Incubation Time: 48 h. Result: Decreased the cell viability in breast cancer cells. Cell Viability Assay[2] Cell Line: RAW-D cells. Concentration: 0-100 μg/mL. Incubation Time: 0-100 μg/mL. Result: Clearly suppressed osteoclastogenesis from the RAW 264 cell D-clone. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 602.1±55.0 °C at 760 mmHg |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.668 |
| Flash Point | 332.0±28.0 °C |
| Exact Mass | 468.323975 |
| PSA | 71.44000 |
| LogP | 6.90 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | ZTKZZRIVAYGFSF-LYWQSRDLSA-N |
| SMILES | CC(=CCCC(C)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(=O)C(C)(C)C1CC3=O)C(=O)O |
| Hazard Codes | Xi |
|---|
| Gaderic acid DM |
| Lanosta-8,24-dien-26-oic acid, 3,7-dioxo-, (24E)- |
| (24E)-3,7-Dioxolanosta-8,24-dien-26-oic acid |