Methyltetrazine-PEG4-maleimide structure
|
Common Name | Methyltetrazine-PEG4-maleimide | ||
|---|---|---|---|---|
| CAS Number | 1802908-02-6 | Molecular Weight | 613.662 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H30N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Methyltetrazine-PEG4-maleimideMethyltetrazine-PEG4-maleimide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Tetrazine-PEG4-maleimide |
|---|---|
| Synonym | More Synonyms |
| Description | Methyltetrazine-PEG4-maleimide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C24H30N6O7 |
| Molecular Weight | 613.662 |
| Exact Mass | 613.286011 |
| LogP | -2.38 |
| Index of Refraction | 1.556 |
| InChIKey | DPEUPJJPNNSKGW-UHFFFAOYSA-N |
| SMILES | Cc1nnc(-c2ccc(OCCOCCOCCOCCNC(=O)CCN3C(=O)C=CC3=O)cc2)nn1 |
| Storage condition | -20°C |
| Methyltetrazine-PEG4-maleimide |
| 1H-Pyrrole-1-butanamide, 2,5-dihydro-N-[17-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]-15-oxo-3,6,9,12-tetraoxa-16-azaheptadec-1-yl]-2,5-dioxo- |
| 20-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-N-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzyl]-17-oxo-4,7,10,13-tetraoxa-16-azaicosan-1-amide |
| MFCD28053555 |
| Tetrazine-PEG4-maleimide |