TCO-PEG4-acid structure
|
Common Name | TCO-PEG4-acid | ||
|---|---|---|---|---|
| CAS Number | 1802913-21-8 | Molecular Weight | 417.494 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 574.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H35NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.2±30.1 °C | |
Use of TCO-PEG4-acidTCO-PEG4-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
| Name | TCO-PEG4-Acid |
|---|---|
| Synonym | More Synonyms |
| Description | TCO-PEG4-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 574.5±50.0 °C at 760 mmHg |
| Molecular Formula | C20H35NO8 |
| Molecular Weight | 417.494 |
| Flash Point | 301.2±30.1 °C |
| Exact Mass | 417.236267 |
| LogP | 1.43 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | PSNKSDUNMXNXDE-UPHRSURJSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCNC(=O)OC1CCC=CCCC1 |
| 1-[(4Z)-4-Cycloocten-1-yloxy]-1-oxo-5,8,11,14-tetraoxa-2-azaheptadecan-17-oic acid |
| MFCD28334565 |
| 5,8,11,14-Tetraoxa-2-azaheptadecan-17-oic acid, 1-[(4Z)-4-cycloocten-1-yloxy]-1-oxo- |