S-acetyl-PEG6-Boc structure
|
Common Name | S-acetyl-PEG6-Boc | ||
|---|---|---|---|---|
| CAS Number | 1818294-39-1 | Molecular Weight | 468.602 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 522.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H40O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.0±18.1 °C | |
Use of S-acetyl-PEG6-BocS-acetyl-PEG6-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | S-acetyl-PEG6-t-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | S-acetyl-PEG6-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 522.5±50.0 °C at 760 mmHg |
| Molecular Formula | C21H40O9S |
| Molecular Weight | 468.602 |
| Flash Point | 242.0±18.1 °C |
| Exact Mass | 468.239288 |
| LogP | 0.44 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | COWMBKVRIKGHSW-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCOCCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C |
| MFCD26127816 |
| 2-Methyl-2-propanyl 2-oxo-6,9,12,15,18,21-hexaoxa-3-thiatetracosan-24-oate |
| 6,9,12,15,18,21-Hexaoxa-3-thiatetracosan-24-oic acid, 2-oxo-, 1,1-dimethylethyl ester |