Ezetimibe Ketone structure
|
Common Name | Ezetimibe Ketone | ||
|---|---|---|---|---|
| CAS Number | 191330-56-0 | Molecular Weight | 407.409 | |
| Density | 1.325 | Boiling Point | 656.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H19F2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 350.6±31.5 °C | |
Use of Ezetimibe KetoneEzetimibe ketone (EZM-K) is a phase-I metabolite of Ezetimibe. Ezetimibe is a Niemann-Pick C1-like1 (NPC1L1) inhibitor, and is a potent Nrf2 activator. Ezetimibe is a potent cholesterol absorption inhibitor[1][2][3]. |
| Name | (3R,4S)-1-(4-Fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)azetidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Ezetimibe ketone (EZM-K) is a phase-I metabolite of Ezetimibe. Ezetimibe is a Niemann-Pick C1-like1 (NPC1L1) inhibitor, and is a potent Nrf2 activator. Ezetimibe is a potent cholesterol absorption inhibitor[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
NPC1L1, Nrf2[1] |
| References |
| Density | 1.325 |
|---|---|
| Boiling Point | 656.1±55.0 °C at 760 mmHg |
| Molecular Formula | C24H19F2NO3 |
| Molecular Weight | 407.409 |
| Flash Point | 350.6±31.5 °C |
| Exact Mass | 407.133301 |
| PSA | 57.61000 |
| LogP | 3.79 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | UEPZDXMEEKCJSP-FYYLOGMGSA-N |
| SMILES | O=C(CCC1C(=O)N(c2ccc(F)cc2)C1c1ccc(O)cc1)c1ccc(F)cc1 |
| Hazard Codes | Xi |
|---|
| 1-(4-fluorophenyl)-3(R)-[3-oxo-3-(4-fluorophenyl)-propyl]-4-(S)-(4-hydroxyphenyl)azetidin-2-one |
| 1-(4-fluorophenyl)-3(R)-[3-(4-fluorophenyl)-3-oxopropyl]-4(S)-(4-hydroxyphenyl)-2-azetidinone |
| (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxo-propyl]-4-(4-hydroxyphenyl)-2-azetidinone |
| AZE016 |
| (3R,4S)-1-(4-Fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)-2-azetidinone |
| (3R,4S)-1-(4-Fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)azetidin-2-one |
| 1-(4-fluorophenyl)-3(R)-[3-oxo-3-(4-fluorophenyl)propyl]-4-(S)-(4-hydroxyphenyl)-2-azetidinone |
| 2-Azetidinone, 1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)-, (3R,4S)- |
| (3R,4S)-1-(4-fluorophenyl)-3-[3-(4-fluorophenyl)-3-oxopropyl]-4-(4-hydroxyphenyl)-azetidin-2-one |
| Ezetimibe Intermediate-X |
| EzetiMibe Ketone |
| Ezetimibe Impurity 12 |