Tosylate of Triethylene glycol monobenzyl ether structure
|
Common Name | Tosylate of Triethylene glycol monobenzyl ether | ||
|---|---|---|---|---|
| CAS Number | 84131-04-4 | Molecular Weight | 394.48200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[2-[2-(phenylmethoxy)ethoxy]ethoxy]ethanol 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H26O6S |
|---|---|
| Molecular Weight | 394.48200 |
| Exact Mass | 394.14500 |
| PSA | 79.44000 |
| LogP | 4.03110 |
| InChIKey | SULYUXLJHONROP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCc2ccccc2)cc1 |
| 2-[2-[2-(benzyloxy)ethoxy]ethoxy]ethyl p-toluenesulfonate |
| 2-(2-(2-(benzyloxy)ethoxy)ethoxy)ethyl 4-methylbenzenesulfonate |
| 2-(2-(2-(benzyloxy)ethoxy)ethoxy)ethyl p-toluenesulfonate |
| 2-[2-(2-benzyloxyethoxy)ethoxy]ethyl p-toluenesulfonate |
| toluene-4-sulfonic acid 2-[2-(2-benzyloxyethoxy)ethoxy]ethyl ester |
| tosyl derivative of triethylene glycol monobenzyl ether |