NSC 604989 structure
|
Common Name | NSC 604989 | ||
|---|---|---|---|---|
| CAS Number | 20007-87-8 | Molecular Weight | 294.30500 | |
| Density | 1.4g/cm3 | Boiling Point | 572.5ºC at 760 mmHg | |
| Molecular Formula | C17H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.1ºC | |
Use of NSC 604989(-)-Cyclopenin ((-)-Cyclopenine) is the enantiomer of Cyclopenin. Cyclopenin is a selective acetylcholinesterase (AChE) inhibitor with the IC50 of 2.04 μM[1]. |
| Name | Cyclopenin |
|---|
| Description | (-)-Cyclopenin ((-)-Cyclopenine) is the enantiomer of Cyclopenin. Cyclopenin is a selective acetylcholinesterase (AChE) inhibitor with the IC50 of 2.04 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 572.5ºC at 760 mmHg |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.30500 |
| Flash Point | 300.1ºC |
| Exact Mass | 294.10000 |
| PSA | 61.94000 |
| LogP | 2.25440 |
| Vapour Pressure | 4.07E-13mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | APLKWZASYUZSBL-PBHICJAKSA-N |
| SMILES | CN1C(=O)c2ccccc2NC(=O)C12OC2c1ccccc1 |