Thalidomide-O-amido-C3-NH2 structure
|
Common Name | Thalidomide-O-amido-C3-NH2 | ||
|---|---|---|---|---|
| CAS Number | 2022182-58-5 | Molecular Weight | 502.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21F3N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-O-amido-C3-NH2E3 Ligase Ligand-Linker Conjugates 52 TFA (Compound 10) incorporates a CRBN ligand for the E3 ubiquitin ligase, and a PROTAC linker. E3 Ligase Ligand-Linker Conjugates 52 TFA (Compound 10) is a PROTAC precursor[1]. |
| Name | E3 Ligase Ligand-Linker Conjugates 52 (TFA) |
|---|
| Description | E3 Ligase Ligand-Linker Conjugates 52 TFA (Compound 10) incorporates a CRBN ligand for the E3 ubiquitin ligase, and a PROTAC linker. E3 Ligase Ligand-Linker Conjugates 52 TFA (Compound 10) is a PROTAC precursor[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| References |
| Molecular Formula | C20H21F3N4O8 |
|---|---|
| Molecular Weight | 502.40 |
| InChIKey | OKTNKIORKNBBAG-UHFFFAOYSA-N |
| SMILES | NCCCNC(=O)COc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O.O=C(O)C(F)(F)F |