(S,R,S)-AHPC-C5-NH2 structure
|
Common Name | (S,R,S)-AHPC-C5-NH2 | ||
|---|---|---|---|---|
| CAS Number | 2170695-19-7 | Molecular Weight | 543.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H41N5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S,R,S)-AHPC-C5-NH2(S,R,S)-AHPC-C5-NH2 (VH032-C5-NH2) is a synthesized E3 ligase ligand-linker conjugate that incorporates the VH032 based VHL ligand and a linker used for estrogen-related receptor α (ERRα) PROTAC degrader[1]. |
| Name | (S,R,S)-AHPC-C5-NH2 |
|---|
| Description | (S,R,S)-AHPC-C5-NH2 (VH032-C5-NH2) is a synthesized E3 ligase ligand-linker conjugate that incorporates the VH032 based VHL ligand and a linker used for estrogen-related receptor α (ERRα) PROTAC degrader[1]. |
|---|---|
| Related Catalog | |
| Target |
VHL |
| References |
| Molecular Formula | C28H41N5O4S |
|---|---|
| Molecular Weight | 543.72 |
| InChIKey | ZXDLSCQCKHBGLQ-OTNCWRBYSA-N |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)CCCCCN)C(C)(C)C)cc1 |