LY-301664 structure
|
Common Name | LY-301664 | ||
|---|---|---|---|---|
| CAS Number | 221176-49-4 | Molecular Weight | 230.28600 | |
| Density | 1.292g/cm3 | Boiling Point | 341.1ºC at 760 mmHg | |
| Molecular Formula | C12H10N2OS | Melting Point | 235-237ºC | |
| MSDS | N/A | Flash Point | 160.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of LY-301664LY-301664 is a bio-active chemical. |
| Name | 2-methyl-5,10-dihydrothieno[3,2-c][1,5]benzodiazepin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 341.1ºC at 760 mmHg |
| Melting Point | 235-237ºC |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.28600 |
| Flash Point | 160.1ºC |
| Exact Mass | 230.05100 |
| PSA | 76.89000 |
| LogP | 2.94150 |
| Vapour Pressure | 8.24E-05mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | LVTDAJJOMLNXFS-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(s1)Nc1ccccc1NC2=O |
| Storage condition | Refrigerator |
| Olanzapine related compound B |
| Olanzapine Impurity |
| UNII-154GKG25DA |
| THI071 |