PKD-IN-1 dihydrochloride structure
|
Common Name | PKD-IN-1 dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2308510-39-4 | Molecular Weight | 415.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21N4OCl3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PKD-IN-1 dihydrochloridePKD-IN-1 dihydrochloride (compound 32), an aminoethylamino-aryl (AEAA) compound, acts as PKD-1 inhibitor. PKD-IN-1 can be used for protein kinase D (PKD)-mediated diseases research[1]. |
| Name | CRT0066101 dihydrochloride(956121-30-5 free base) |
|---|
| Description | PKD-IN-1 dihydrochloride (compound 32), an aminoethylamino-aryl (AEAA) compound, acts as PKD-1 inhibitor. PKD-IN-1 can be used for protein kinase D (PKD)-mediated diseases research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H21N4OCl3 |
|---|---|
| Molecular Weight | 415.74 |
| InChIKey | ASWGDWBLOLWOED-CURYUGHLSA-N |
| SMILES | CCC(N)CNc1nc(-c2cc(Cl)ccc2O)nc2ccccc12.Cl.Cl |