MP-PEG4-VK(Boc)G-OSu structure
|
Common Name | MP-PEG4-VK(Boc)G-OSu | ||
|---|---|---|---|---|
| CAS Number | 2378428-21-6 | Molecular Weight | 897.97 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H63N7O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MP-PEG4-VK(Boc)G-OSuMP-PEG4-VK(Boc)G-OSu is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | MP-PEG4-VK(Boc)G-OSu |
|---|
| Description | MP-PEG4-VK(Boc)G-OSu is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| References |
[1]. Jeffrey S, et, al. Camptothecin peptide conjugates. WO2019195665A1. |
| Molecular Formula | C40H63N7O16 |
|---|---|
| Molecular Weight | 897.97 |
| InChIKey | PACRZKFVWJUBCK-GOOPYHEFSA-N |
| SMILES | CC(C)C(NC(=O)CCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O)C(=O)NC(CCCCNC(=O)OC(C)(C)C)C(=O)NCC(=O)ON1C(=O)CCC1=O |