PI3Kα-IN-7 structure
|
Common Name | PI3Kα-IN-7 | ||
|---|---|---|---|---|
| CAS Number | 2417098-53-2 | Molecular Weight | 402.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22N8O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PI3Kα-IN-7PI3Kα-IN-7 (Compound A12) is a potent PI3Kα inhibitor. PI3Kα-IN-7 also inhibits PI3Kβ. PI3Kα-IN-7 decreases cancer cells mitochondrial membrane potential and induces apoptosis[1]. |
| Name | PI3Kα-IN-7 |
|---|
| Description | PI3Kα-IN-7 (Compound A12) is a potent PI3Kα inhibitor. PI3Kα-IN-7 also inhibits PI3Kβ. PI3Kα-IN-7 decreases cancer cells mitochondrial membrane potential and induces apoptosis[1]. |
|---|---|
| Related Catalog | |
| Target |
PI3Kα PI3Kβ |
| In Vitro | PI3Kα-IN-7 (Compound A12) shows potent antitumor activities against HCT116, PC-3, MCF-7, A549 and MDA-MB-231 cell lines with IC50 values of 3.24 μM, 14.37 μM, 7.39 μM, 7.10 μM, and 16.85 μM, respectively[1]. |
| References |
| Molecular Formula | C17H22N8O2S |
|---|---|
| Molecular Weight | 402.47 |
| InChIKey | BYQNMHAMDSQNGI-UHFFFAOYSA-N |
| SMILES | c1c(CNC2=NCN=N2)sc2c(N3CCOCC3)nc(N3CCOCC3)nc12 |