4-Hydroxyphenyl hydantoin structure
|
Common Name | 4-Hydroxyphenyl hydantoin | ||
|---|---|---|---|---|
| CAS Number | 2420-17-9 | Molecular Weight | 192.171 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H8N2O3 | Melting Point | >260°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-hydroxyphenyl)imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Melting Point | >260°C |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.171 |
| Exact Mass | 192.053497 |
| PSA | 78.43000 |
| LogP | -0.28 |
| Index of Refraction | 1.607 |
| InChIKey | UMTNMIARZPDSDI-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(c2ccc(O)cc2)N1 |
| Hazard Codes | C |
|---|---|
| Risk Phrases | R34:Causes burns. R42/43:May cause sensitization by inhalation and skin contact . R52/53:Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment . |
| Safety Phrases | S22-S26-S36/37/39-S45-S61 |
| RIDADR | UN 2579 8/PG 3 |
| WGK Germany | 1 |
| RTECS | TK7800000 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00044002 |
| 5-(4-Hydroxyphenyl)imidazolidine-2,4-dione |
| 2,4-Imidazolidinedione, 5-(4-hydroxyphenyl)- |
| EINECS 219-340-8 |
| 5-(4-Hydroxyphenyl)-2,4-imidazolidinedione |
| 5-(p-Hydroxyphenyl)hydantoin |
| 5-(4-hydroxy-phenyl)-imidazolidine-2,4-dione |
| 5-(4-Hydroxy-phenyl)-imidazolidin-2,4-dion |
| 5-(4'-hydroxyphenyl)-hydantoin |
| 4-Hydroxyphenyl hydantoin |