p38α inhibitor 3 structure
|
Common Name | p38α inhibitor 3 | ||
|---|---|---|---|---|
| CAS Number | 260428-69-1 | Molecular Weight | 297.3666032 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 443.9±28.0 °C at 760 mmHg | |
| Molecular Formula | C19H20FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.3±24.0 °C | |
Use of p38α inhibitor 3p38α inhibitor 3 (Comp G7) is a p38α inhibitor that blocks the effectiveness of myoblast differentiation[1]. |
| Name | WAY-313218 |
|---|---|
| Synonym | More Synonyms |
| Description | p38α inhibitor 3 (Comp G7) is a p38α inhibitor that blocks the effectiveness of myoblast differentiation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 443.9±28.0 °C at 760 mmHg |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.3666032 |
| Flash Point | 222.3±24.0 °C |
| Exact Mass | 297.152893 |
| LogP | 3.65 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | VALGZDLHWXYOBZ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(F)cc1)N1CCC(Cc2ccccc2)CC1 |
| (4-Benzyl-piperidin-1-yl)-(4-fluoro-phenyl)-methanone |
| Methanone, (4-fluorophenyl)[4-(phenylmethyl)-1-piperidinyl]- |
| (4-Benzyl-1-piperidinyl)(4-fluorophenyl)methanone |