PF-07258669 structure
|
Common Name | PF-07258669 | ||
|---|---|---|---|---|
| CAS Number | 2755890-53-8 | Molecular Weight | 462.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H27FN6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PF-07258669PF-07258669 is a melanocortin-4 receptor (MC4) antagonist. PF-07258669 can be used for the research of cachexia, anorexia, or anorexia nervosa[1]. |
| Name | PF-07258669 |
|---|
| Description | PF-07258669 is a melanocortin-4 receptor (MC4) antagonist. PF-07258669 can be used for the research of cachexia, anorexia, or anorexia nervosa[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H27FN6O2 |
|---|---|
| Molecular Weight | 462.52 |
| InChIKey | PARGFYLSRQUWHR-BZQUYTCOSA-N |
| SMILES | COc1cc(C(C)C(=O)N2CCC3(CCc4cc(-c5ncccn5)c(C)nc4N3)C2)c(F)cn1 |