1H-Isoindole-1,3(2H)-dione,2-(4-nitrophenyl)- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-(4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 31604-39-4 | Molecular Weight | 268.22400 | |
| Density | 1.501g/cm3 | Boiling Point | 494.2ºC at 760 mmHg | |
| Molecular Formula | C14H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.7ºC | |
| Name | 2-(4-nitrophenyl)isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.501g/cm3 |
|---|---|
| Boiling Point | 494.2ºC at 760 mmHg |
| Molecular Formula | C14H8N2O4 |
| Molecular Weight | 268.22400 |
| Flash Point | 252.7ºC |
| Exact Mass | 268.04800 |
| PSA | 83.20000 |
| LogP | 2.98360 |
| Index of Refraction | 1.694 |
| InChIKey | PHBJJKVNDZUAGC-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2925190090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(4-nitrophenyl)isoindoline-1,3-dione |
| 2-(4-nitrophenyl)-1H-isoindole-1,3(2H)-dione |
| 2-(4-NITRO-PHENYL)-ISOINDOLE-1,3-DIONE |
| 1H-Isoindole-1,3(2H)-dione,2-(4-nitrophenyl) |
| N-[4'-(nitrophenyl)]phthalimide |
| N-p-nitrophenylphthalimide |
| N-(p-nitrophenyl)phthalanilic acid |