Azido-PEG6-C2-Boc structure
|
Common Name | Azido-PEG6-C2-Boc | ||
|---|---|---|---|---|
| CAS Number | 406213-76-1 | Molecular Weight | 435.512 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H37N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG6-C2-BocAzido-PEG6-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Methyl-2-propanyl 1-azido-3,6,9,12,15,18-hexaoxahenicosan-21-oate |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG6-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C19H37N3O8 |
|---|---|
| Molecular Weight | 435.512 |
| Exact Mass | 435.258057 |
| LogP | -0.09 |
| InChIKey | HRNUWAOLFSWRDG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| Storage condition | 2-8°C |
| 2-Methyl-2-propanyl 1-azido-3,6,9,12,15,18-hexaoxahenicosan-21-oate |
| 3,6,9,12,15,18-Hexaoxaheneicosan-21-oic acid, 1-azido-, 1,1-dimethylethyl ester |