Azido-PEG6-PFP ester structure
|
Common Name | Azido-PEG6-PFP ester | ||
|---|---|---|---|---|
| CAS Number | 1818294-47-1 | Molecular Weight | 545.454 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H28F5N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG6-PFP esterAzido-PEG6-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG6-PFP ester |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG6-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C21H28F5N3O8 |
|---|---|
| Molecular Weight | 545.454 |
| Exact Mass | 545.179626 |
| LogP | 0.95 |
| InChIKey | YVHKCEARDWOLPA-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| 3,6,9,12,15,18-Hexaoxaheneicosan-21-oic acid, 1-azido-, 2,3,4,5,6-pentafluorophenyl ester |
| Pentafluorophenyl 1-azido-3,6,9,12,15,18-hexaoxahenicosan-21-oate |
| MFCD26793784 |