Nonylbenzene-PEG8-OH structure
|
Common Name | Nonylbenzene-PEG8-OH | ||
|---|---|---|---|---|
| CAS Number | 41506-14-3 | Molecular Weight | 572.77100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H56O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Nonylbenzene-PEG8-OHNonylbenzene-PEG8-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1(1-Hydroxy-4,7,10,13,16,19,22-heptaoxa)tetracosyl-4-nonylbenzol |
|---|---|
| Synonym | More Synonyms |
| Description | Nonylbenzene-PEG8-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C31H56O9 |
|---|---|
| Molecular Weight | 572.77100 |
| Exact Mass | 572.39200 |
| PSA | 94.07000 |
| LogP | 4.46700 |
| InChIKey | XXPRRHYTDCWGRP-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCc1ccc(OCCOCCOCCOCCOCCOCCOCCOCCO)cc1 |
| 2-[2-(2-{2-[2-(2-{2-[2-(4-Nonyl-phenoxy)-ethoxy]-ethoxy}-ethoxy)-ethoxy]-ethoxy}-ethoxy)-ethoxy]-ethanol |
| nonylphenol ethoxylate |
| nonylphenyl ethoxyle |
| Igepal BC8 |