Boc-NH-PEG3-CH2COOH structure
|
Common Name | Boc-NH-PEG3-CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 462100-06-7 | Molecular Weight | 307.34000 | |
| Density | 1.141±0.06 g/cm3 | Boiling Point | 460.1±35.0°C at 760 mmHg | |
| Molecular Formula | C13H25NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Boc-NH-PEG3-CH2COOHBoc-NH-PEG3-CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTAC[1]. |
| Name | Boc-11-amino-3,6,9-trioxaundecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-NH-PEG3-CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTAC[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Density | 1.141±0.06 g/cm3 |
|---|---|
| Boiling Point | 460.1±35.0°C at 760 mmHg |
| Molecular Formula | C13H25NO7 |
| Molecular Weight | 307.34000 |
| Exact Mass | 307.16300 |
| PSA | 103.32000 |
| LogP | 1.03640 |
| InChIKey | IFSMYFLQPDFUOI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCC(=O)O |
| Water Solubility | Soluble (68 g/L) (25 ºC) |
| Boc-NH-PEG3-COOH |
| {2-[2-(2-tert-butoxycarbonylamino-ethoxy)-ethoxy]-ethoxy}-acetic acid |
| 2-[2-{2-(N-tert-butoxycarbonyl)aminoethoxy}ethoxy]ethoxyacetic acid |
| 2,2-dimethyl-4-oxo-3,8,11,14-tetraoxa-5-azohexadecan-16-oic acid |
| 11-N-t-Boc-amino-3,6,9-trioxaundecanoic acid |
| Boc-NH-mini-PEG-COOH |
| 5,8,11-Trioxa-2-azatridecanedioic acid 1-(1,1-dimethylethyl) ester |