Boc-NH-PEG2-CH2COOH structure
|
Common Name | Boc-NH-PEG2-CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 108466-89-3 | Molecular Weight | 263.28800 | |
| Density | N/A | Boiling Point | 630.4°C | |
| Molecular Formula | C11H21NO6 | Melting Point | 240°C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Boc-NH-PEG2-CH2COOHBoc-NH-PEG2-CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
| Name | 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-NH-PEG2-CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Boiling Point | 630.4°C |
|---|---|
| Melting Point | 240°C |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.28800 |
| Exact Mass | 263.13700 |
| PSA | 97.58000 |
| LogP | 0.83330 |
| InChIKey | OMBVJVWVXRNDSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCC(=O)O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatridecan-13-oic acid |
| 8-tert-Butyloxycarbonylamino-3,6-dioxaoctanoic Acid |
| AmbotzBAA1466 |
| Boc-AEEA |
| 2-[2-[2-(Boc-amino)ethoxy]ethoxy]acetic Acid |