Ayanin structure
|
Common Name | Ayanin | ||
|---|---|---|---|---|
| CAS Number | 572-32-7 | Molecular Weight | 344.315 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 600.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C18H16O7 | Melting Point | 173℃ | |
| MSDS | N/A | Flash Point | 221.5±25.0 °C | |
Use of AyaninAyanin is a bioflavonoid isolated from Croton schiedeanus Schlecht. Ayanin is a non-selective phosphodiesterase1-4 inhibitor and can be used for the study of respiratory disease,such as allergic asthma et al[1]. |
| Name | 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7-dimethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Ayanin is a bioflavonoid isolated from Croton schiedeanus Schlecht. Ayanin is a non-selective phosphodiesterase1-4 inhibitor and can be used for the study of respiratory disease,such as allergic asthma et al[1]. |
|---|---|
| Related Catalog | |
| Target |
PDE2A PDE4 |
| In Vitro | Ayanin inhibits interleukin (IL)-4 production from purified basophils with an IC50 value of 2.2 μM[1]. |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 600.8±55.0 °C at 760 mmHg |
| Melting Point | 173℃ |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.315 |
| Flash Point | 221.5±25.0 °C |
| Exact Mass | 344.089600 |
| PSA | 98.36000 |
| LogP | 2.43 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | KPCRYSMUMBNTCK-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(=O)c(OC)c(-c3ccc(OC)c(O)c3)oc2c1 |
| Hazard Codes | Xi |
|---|
| 3',5-Dihydroxy-3,4',7-trimethoxyflavone |
| 3,4',7-O-trimethylquercetin |
| 4H-1-Benzopyran-4-one, 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7-dimethoxy- |
| 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7-dimethoxy-4H-chromen-4-one |
| quercetin-3,4',7-trimethyl ether |
| 3,7,4'-trimethylquercetin |
| 3,7,4'-trimethoxy-5,3'-dihydroxyflavone |
| 5,3'-Dihydroxy-3,7,4'-trimethoxyflavone |
| Ayanin |
| 3,7,4'-Tri-O-methylquercetin |
| 3',5-dihydroxy-3,4',7-trimethoxy-flavone |