Fmoc-NH-PEG5-CH2COOH structure
|
Common Name | Fmoc-NH-PEG5-CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 635287-26-2 | Molecular Weight | 517.56800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H35NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-NH-PEG5-CH2COOHFmoc-NH-PEG5-CH2COOH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | {2-[2-(2-{2-[2-(9H-fluoren-9-yl-methoxycarbonylamino)-ethoxy]-ethoxy}-ethoxy)-ethoxy]-ethoxy}acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-NH-PEG5-CH2COOH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
[1]. Liuhong CHEN, et al. Multimeric bicyclic peptide ligands. WO2019162682A1. |
| Molecular Formula | C27H35NO9 |
|---|---|
| Molecular Weight | 517.56800 |
| Exact Mass | 517.23100 |
| PSA | 121.78000 |
| LogP | 3.08360 |
| InChIKey | LNIFRTLAPAPKAG-UHFFFAOYSA-N |
| SMILES | O=C(O)COCCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Fmoc-NH-5(ethylene glycol)-acetic acid |
| FMOC-NH-DPEG5-COOH |
| Fmoc-NH-PEG5-CH2COOH |
| Fmoc-NH-5(ethylene glycol)-actic acid |
| 5,8,11,14,17-Pentaoxa-2-azanonadecanedioic acid 1-(9H-fluoren-9-ylmethyl) ester |