Endotoxin Substrate acetate salt structure
|
Common Name | Endotoxin Substrate acetate salt | ||
|---|---|---|---|---|
| CAS Number | 68223-96-1 | Molecular Weight | 564.635 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C25H40N8O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Endotoxin Substrate acetate saltEndotoxin Substrate (Boc-LGR-pNA) is a chromogenic substrate can be used in quantitative assays of endotoxin[1]. |
| Name | endotoxin substrate |
|---|---|
| Synonym | More Synonyms |
| Description | Endotoxin Substrate (Boc-LGR-pNA) is a chromogenic substrate can be used in quantitative assays of endotoxin[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C25H40N8O7 |
| Molecular Weight | 564.635 |
| Exact Mass | 564.302002 |
| PSA | 233.35000 |
| LogP | 1.51 |
| Index of Refraction | 1.595 |
| InChIKey | XYZOMPCEZFRTOR-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(=O)NCC(=O)NC(CCCN=C(N)N)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| Glycinamide, N-[(1,1-dimethylethoxy)carbonyl]-L-leucyl-N-[(2S)-5-[(diaminomethylene)amino]-2-[(4-nitrophenyl)amino]-1-oxopentyl]- |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-leucyl-N-{(2S)-5-[(diaminomethylene)amino]-2-[(4-nitrophenyl)amino]pentanoyl}glycinamide |
| Boc-Leu-Gly-Arg-pNA |