PKM2 activator 5
Modify Date: 2025-11-28 22:39:44
PKM2 activator 5 structure
|
Common Name | PKM2 activator 5 | ||
|---|---|---|---|---|
| CAS Number | 796092-26-7 | Molecular Weight | 442.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19FN2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PKM2 activator 5PKM2 activator 5 (compound 8) is a PKM2 activator with an AC50 value of 0.316 µM. PKM2 activator 5 has the potential to alter the aberrant metabolism of cancer cells[1]. |
| Name | WAY-638774 |
|---|
| Description | PKM2 activator 5 (compound 8) is a PKM2 activator with an AC50 value of 0.316 µM. PKM2 activator 5 has the potential to alter the aberrant metabolism of cancer cells[1]. |
|---|---|
| Related Catalog | |
| Target |
PKM2[1]. |
| Molecular Formula | C18H19FN2O6S2 |
|---|---|
| Molecular Weight | 442.48 |
| InChIKey | SOEFEUAERZUSNF-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1 |