TC SL C5 structure
|
Common Name | TC SL C5 | ||
|---|---|---|---|---|
| CAS Number | 827327-28-6 | Molecular Weight | 323.39 | |
| Density | 1.14±0.1 g/cm3(Predicted) | Boiling Point | 534.0±60.0 °C(Predicted) | |
| Molecular Formula | C19H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TC SL C5MALAT1-IN-1 (compounds 5) is a potent and specific Malat1 (Metastasis-associated lung adenocarcinoma transcript 1) inhibitor. MALAT1-IN-1 modulated Malat1 downstream genes in a dose-dependent manner without affecting expression of nuclear enriched abundant transcript 1 (Neat1) [1]. |
| Name | MALAT1-IN-1 |
|---|
| Description | MALAT1-IN-1 (compounds 5) is a potent and specific Malat1 (Metastasis-associated lung adenocarcinoma transcript 1) inhibitor. MALAT1-IN-1 modulated Malat1 downstream genes in a dose-dependent manner without affecting expression of nuclear enriched abundant transcript 1 (Neat1) [1]. |
|---|---|
| Related Catalog | |
| Target |
Malat1[1] |
| References |
| Density | 1.14±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 534.0±60.0 °C(Predicted) |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.39 |
| InChIKey | LCVOJBGSGIOMKF-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cnc(NCc3cccc(OC)c3)n2C)cc1 |
| Hazard Codes | Xn |
|---|