Tosylate of Hexaethylene glycol monobenzyl ether structure
|
Common Name | Tosylate of Hexaethylene glycol monobenzyl ether | ||
|---|---|---|---|---|
| CAS Number | 129086-11-9 | Molecular Weight | 526.64000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H38O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tosylate of Hexaethylene glycol monobenzyl etherBenzyl-PEG6-Ots is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | 19-Phenyl-3,6,9, 12,15,18-hexaoxanonadec-1-yl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Benzyl-PEG6-Ots is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| Molecular Formula | C26H38O9S |
|---|---|
| Molecular Weight | 526.64000 |
| Exact Mass | 526.22400 |
| PSA | 107.13000 |
| LogP | 4.08090 |
| InChIKey | ISGUVDRQXACIEJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCCOCCOCc2ccccc2)cc1 |
| Hazard Codes | Xi |
|---|
| Toluene-4-sulfonic acid 2-[2-(2-{2-[2-(2-benzyloxy-ethoxy)-ethoxy]-ethoxy}-ethoxy)-ethoxy]-ethyl ester |