Mogroside II-A2 structure
|
Common Name | Mogroside II-A2 | ||
|---|---|---|---|---|
| CAS Number | 88901-45-5 | Molecular Weight | 801.013 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 914.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C42H72O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 506.7±34.3 °C | |
Use of Mogroside II-A2Mogroside II-A2, a triterpenoid glycoside isolated from the extracts of Luo Han Guo, is a nonsugar sweetener. Mogrosides are sweeter than sucrose. Mogrosides exhibit antioxidant, antidiabetic and anticancer activities[1]. |
| Name | β-D-Glucopyranoside, (3β,9β,10α,11α,24R)-11,24,25-trihydroxy-9-methyl-19-norlanost-5-en-3-yl 6-O-β-D-glucopyranosyl |
|---|---|
| Synonym | More Synonyms |
| Description | Mogroside II-A2, a triterpenoid glycoside isolated from the extracts of Luo Han Guo, is a nonsugar sweetener. Mogrosides are sweeter than sucrose. Mogrosides exhibit antioxidant, antidiabetic and anticancer activities[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 914.2±65.0 °C at 760 mmHg |
| Molecular Formula | C42H72O14 |
| Molecular Weight | 801.013 |
| Flash Point | 506.7±34.3 °C |
| Exact Mass | 800.492188 |
| PSA | 239.22000 |
| LogP | 3.46 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | SLAWMGMTBGDBFT-XKSPGJGDSA-N |
| SMILES | CC(CCC(O)C(C)(C)O)C1CCC2(C)C3CC=C4C(CCC(OC5OC(COC6OC(CO)C(O)C(O)C6O)C(O)C(O)C5O)C4(C)C)C3(C)C(O)CC12C |
| mogroside ⅡA2 |
| Mogroside II-A2 |
| Mogroside-IIA2 |
| Mogroside II A2 |
| (1S,4R,8β,9β,11α,17ξ,24R)-11,24,25-Trihydroxy-9,10,14-trimethyl-4,9-cyclo-9,10-secocholest-5-en-1-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| β-D-Glucopyranoside, (3β,8α,9β,10α,11α)-17-[(1R,4R)-4,5-dihydroxy-1,5-dimethylhexyl]-11-hydroxy-4,4,9,14-tetramethylestr-5-en-3-yl 6-O-β-D-glucopyranosyl- |