SCD inhibitor 1 structure
|
Common Name | SCD inhibitor 1 | ||
|---|---|---|---|---|
| CAS Number | 1150701-66-8 | Molecular Weight | 391.251 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H16Cl2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SCD inhibitor 1SCD inhibitor 1 is a stearoyl-coa desaturase (SCD) extracted from patent WO/2009060053 A1, compound example 16. |
| Name | SCD inhibitor 1 |
|---|---|
| Synonym | More Synonyms |
| Description | SCD inhibitor 1 is a stearoyl-coa desaturase (SCD) extracted from patent WO/2009060053 A1, compound example 16. |
|---|---|
| Related Catalog | |
| Target |
Stearoyl-CoA Desaturase (SCD)[1] |
| In Vitro | SCD inhibitor 1 is a stearoyl-coa desaturase (SCD), which can be used to treat and/or preventing various diseases, including those mediated by SCD enzyme, such as diseases related to elevated lipid levels, cardiovascular disease, diabetes, obesity, metabolic syndrome, skin disorders such as acne, diseases or conditions related to cancer and the treatment of symptoms linked to the production of the amyloid plaque-forming Aβ42 peptide such as Alzheimer's disease[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C18H16Cl2N4O2 |
| Molecular Weight | 391.251 |
| Exact Mass | 390.065033 |
| LogP | 2.13 |
| Index of Refraction | 1.665 |
| InChIKey | QQRGSFYTPBYCFD-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)Nc2ccc(CO)cc2)nnn1Cc1ccc(Cl)c(Cl)c1 |
| 1H-1,2,3-Triazole-4-carboxamide, 1-[(3,4-dichlorophenyl)methyl]-N-[4-(hydroxymethyl)phenyl]-5-methyl- |
| 1-(3,4-Dichlorobenzyl)-N-[4-(hydroxymethyl)phenyl]-5-methyl-1H-1,2,3-triazole-4-carboxamide |