Fmoc-N-amido-PEG3-azide
Modify Date: 2025-09-24 22:36:08
Fmoc-N-amido-PEG3-azide structure
|
Common Name | Fmoc-N-amido-PEG3-azide | ||
|---|---|---|---|---|
| CAS Number | 1172605-58-1 | Molecular Weight | 440.49200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H28N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-N-amido-PEG3-azideFmoc-N-amido-PEG3-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1-(Fmoc-amino)-11-azido-3,6,9-trioxaundecane |
|---|
| Description | Fmoc-N-amido-PEG3-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C23H28N4O5 |
|---|---|
| Molecular Weight | 440.49200 |
| Exact Mass | 440.20600 |
| PSA | 115.77000 |
| LogP | 3.72886 |
| InChIKey | DPFYHVJTBNQVPA-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |