Boc-NH-PEG1-CH2CH2COOH structure
|
Common Name | Boc-NH-PEG1-CH2CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 1260092-44-1 | Molecular Weight | 233.262 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 385.0±27.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.7±23.7 °C | |
Use of Boc-NH-PEG1-CH2CH2COOHBoc-NH-PEG1-CH2CH2COOH is a cleavable (1 unit PEG) ADC linker and also a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of antibody-drug conjugates (ADCs) or PROTACs[1][2]. |
| Name | 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-NH-PEG1-CH2CH2COOH is a cleavable (1 unit PEG) ADC linker and also a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of antibody-drug conjugates (ADCs) or PROTACs[1][2]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1].PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 385.0±27.0 °C at 760 mmHg |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.262 |
| Flash Point | 186.7±23.7 °C |
| Exact Mass | 233.126328 |
| LogP | 0.93 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | YGNSGMAPLOVGIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCC(=O)O |
| Propanoic acid, 3-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethoxy]- |
| 3-[2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)ethoxy]propanoic acid |
| MFCD22574796 |
| t-Boc-N-amido-PEG1-acid |
| t-boc-N-amido-PEG1-propionic acid |