Boc-NH-PEG6-CH2CH2COOH structure
|
Common Name | Boc-NH-PEG6-CH2CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 882847-13-4 | Molecular Weight | 453.52400 | |
| Density | 1.123±0.06 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H39NO10 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Boc-NH-PEG6-CH2CH2COOHBoc-NH-PEG6-CH2CH2COOH is a cleavable ADC linker used as a linker for antibody-drug conjugates (ADC)[1]. |
| Name | 3-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-NH-PEG6-CH2CH2COOH is a cleavable ADC linker used as a linker for antibody-drug conjugates (ADC)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Density | 1.123±0.06 g/cm3 |
|---|---|
| Molecular Formula | C20H39NO10 |
| Molecular Weight | 453.52400 |
| Exact Mass | 453.25700 |
| PSA | 131.01000 |
| LogP | 1.47630 |
| InChIKey | FTTYOIHYERRXQB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCC(=O)O |
| Storage condition | 2-8°C |
| Water Solubility | Freely soluble (150 g/L) (25 ºC) |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29225090 |
| 21-(Boc-aMino)-4,7,10,13,16,19-hexaoxaheneicosanoic acid |
| Boc-21-amino-4,7,10,13,16,19-hexaoxaheneicosanoic acid |
| Boc-N-amido-PEG6-acid |
| Boc-NH-PEG6-CH2CH2COOH |
| 5,8,11,14,17,20-Hexaoxa-2-azatricosanedioic acid 1-(1,1-dimethylethyl) ester |