Boc-NH-PEG2-CH2CH2COOH structure
|
Common Name | Boc-NH-PEG2-CH2CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 1365655-91-9 | Molecular Weight | 277.314 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 429.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H23NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8±25.9 °C | |
Use of Boc-NH-PEG2-CH2CH2COOHBoc-NH-PEG2-CH2CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTAC[1]. |
| Name | 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-NH-PEG2-CH2CH2COOH is a PEG-based PROTAC linker can be used in the synthesis of PROTAC[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.9±35.0 °C at 760 mmHg |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.314 |
| Flash Point | 213.8±25.9 °C |
| Exact Mass | 277.152527 |
| LogP | 0.57 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.465 |
| InChIKey | OZMXZVCAXAQCHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCC(=O)O |
| 2,2-Dimethyl-4-oxo-3,8,11-trioxa-5-azatetradecan-14-oic acid |
| 3,8,11-Trioxa-5-azatetradecan-14-oic acid, 2,2-dimethyl-4-oxo- |
| MFCD22056304 |
| N-Boc-3-[2-(2-aminoethoxy)ethoxy]propionic Acid |