TAMRA-PEG4-NHS ester structure
|
Common Name | TAMRA-PEG4-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 2171068-83-8 | Molecular Weight | 774.82 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H46N4O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TAMRA-PEG4-NHS esterTAMRA-PEG4-NHS ester is a TAMRA red fluorescent dye derivative containing an NHS ester group which can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. |
| Name | TAMRA-PEG4-NHS ester |
|---|
| Description | TAMRA-PEG4-NHS ester is a TAMRA red fluorescent dye derivative containing an NHS ester group which can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. |
|---|
| Molecular Formula | C40H46N4O12 |
|---|---|
| Molecular Weight | 774.82 |
| InChIKey | PKALNTYPHULONG-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc2c(-c3ccc(C(=O)NCCOCCOCCOCCOCCC(=O)ON4C(=O)CCC4=O)cc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1 |