Bis-PEG4-NHS ester structure
|
Common Name | Bis-PEG4-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1314378-11-4 | Molecular Weight | 488.443 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 605.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C20H28N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.8±34.3 °C | |
Use of Bis-PEG4-NHS esterBis-PEG4-NHS ester is a nonclaevable 4-unit PEG linker for antibody-drug-conjugation (ADC). |
| Name | 1,1'-[(1,16-Dioxo-4,7,10,13-tetraoxahexadecane-1,16-diyl)bis(oxy)]di(2,5-pyrrolidinedione) |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-PEG4-NHS ester is a nonclaevable 4-unit PEG linker for antibody-drug-conjugation (ADC). |
|---|---|
| Related Catalog | |
| Target |
Noncleavable |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 605.1±65.0 °C at 760 mmHg |
| Molecular Formula | C20H28N2O12 |
| Molecular Weight | 488.443 |
| Flash Point | 319.8±34.3 °C |
| Exact Mass | 488.164215 |
| LogP | -4.59 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | BQLKLYYHZOLCLV-UHFFFAOYSA-N |
| SMILES | O=C(CCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| Storage condition | -20°C |
| Hazard Codes | Xn |
|---|
| 1,1'-[(1,16-Dioxo-4,7,10,13-tetraoxahexadecane-1,16-diyl)bis(oxy)]di(2,5-pyrrolidinedione) |
| MFCD20228963 |
| 2,5-Pyrrolidinedione, 1,1'-[(1,16-dioxo-4,7,10,13-tetraoxahexadecane-1,16-diyl)bis(oxy)]bis- |