Cinnamyl-3,4-dihydroxy-α-cyanocinnamate structure
|
Common Name | Cinnamyl-3,4-dihydroxy-α-cyanocinnamate | ||
|---|---|---|---|---|
| CAS Number | 132465-11-3 | Molecular Weight | 321.32700 | |
| Density | 1.326 g/cm3 | Boiling Point | 583.9ºC at 760 mmHg | |
| Molecular Formula | C19H15NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 307ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of Cinnamyl-3,4-dihydroxy-α-cyanocinnamateCinnamyl-3,4-dihydroxy-α-cyanocinnamate (CDC) is a potent 12/15-Lipoxygenases (LO) inhibitor. Cinnamyl-3,4-dihydroxy-α-cyanocinnamate has the potential for the research of type 1 diabetes mellitus[1]. |
| Name | cdc |
|---|
| Description | Cinnamyl-3,4-dihydroxy-α-cyanocinnamate (CDC) is a potent 12/15-Lipoxygenases (LO) inhibitor. Cinnamyl-3,4-dihydroxy-α-cyanocinnamate has the potential for the research of type 1 diabetes mellitus[1]. |
|---|---|
| Related Catalog | |
| In Vitro | High glucose or 12(S)-HETE remarkably increased transendothelial dextran transport, and in combination it was increased further. Addition of the 12/15-LO inhibitor, CDC, partially suppressed dextran transport[1]. |
| In Vivo | The high glucose and 12(S)-hydroxyeicosatetraenoic acid (HETE) could alter vascular endothelial (VE)-cadherin and β‐catenin phosphorylation levels, but did not alter total protein expression. However, the 12/15-LO inhibitor, Cinnamyl-3,4-dihydroxy-α-cyanocinnamate (CDC), antagonized the effect of high glucose on protein phosphorylation to mitigate destruction of the endothelial cell barrier, and the mouse diabetes mellitus model further confirmed these conclusions[1]. |
| References |
| Density | 1.326 g/cm3 |
|---|---|
| Boiling Point | 583.9ºC at 760 mmHg |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.32700 |
| Flash Point | 307ºC |
| Exact Mass | 321.10000 |
| PSA | 90.55000 |
| LogP | 3.26138 |
| InChIKey | XGHYFEJMJXGPGN-UYHGDYIZSA-N |
| SMILES | N#CC(=Cc1ccc(O)c(O)c1)C(=O)OCC=Cc1ccccc1 |
| Storage condition | -20°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H410 |
| Precautionary Statements | P273-P280-P501 |
| Hazard Codes | Xi |
| Risk Phrases | 43-50/53 |
| Safety Phrases | 36/37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| Precursor 1 | |
|---|---|
| DownStream 0 | |