Oxypeucedanin hydrate structure
|
Common Name | Oxypeucedanin hydrate | ||
|---|---|---|---|---|
| CAS Number | 133164-11-1 | Molecular Weight | 304.295 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 544.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.0±30.1 °C | |
Use of Oxypeucedanin hydrate(-)-Oxypeucedanin hydrate ((-)-Prangol) is a derivative of furocoumarin isolated from Ducrosia anethifolia[1]. |
| Name | (S)-4-(2,3-dihydroxy-3-methylbutoxy)-7H-furo[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Oxypeucedanin hydrate ((-)-Prangol) is a derivative of furocoumarin isolated from Ducrosia anethifolia[1]. |
|---|---|
| Related Catalog | |
| In Vitro | D. anethifolia furocoumarin shows antiproliferative and cytotoxic activities[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 544.3±50.0 °C at 760 mmHg |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.295 |
| Flash Point | 283.0±30.1 °C |
| Exact Mass | 304.094696 |
| PSA | 93.04000 |
| LogP | 1.31 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | PEWFWDOPJISUOK-ZDUSSCGKSA-N |
| SMILES | CC(C)(O)C(O)COc1c2ccoc2cc2oc(=O)ccc12 |
| Hazard Codes | Xi |
|---|
| 7H-Furo[3,2-g][1]benzopyran-7-one, 4-[(2S)-2,3-dihydroxy-3-methylbutoxy]- |
| 4-[(2S)-2,3-Dihydroxy-3-methylbutoxy]-7H-furo[3,2-g]chromen-7-one |
| Oxypeucedanin hydrate |