Bis-PEG7-PFP ester structure
|
Common Name | Bis-PEG7-PFP ester | ||
|---|---|---|---|---|
| CAS Number | 1334170-01-2 | Molecular Weight | 758.552 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 664.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H32F10O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.1±26.4 °C | |
Use of Bis-PEG7-PFP esterBis-PEG7-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Bis(pentafluorophenyl) 4,7,10,13,16,19,22-heptaoxapentacosane-1,25-dioate |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-PEG7-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 664.2±55.0 °C at 760 mmHg |
| Molecular Formula | C30H32F10O11 |
| Molecular Weight | 758.552 |
| Flash Point | 342.1±26.4 °C |
| Exact Mass | 758.178467 |
| LogP | 2.84 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.465 |
| InChIKey | NEFPGEFWBAKGRR-UHFFFAOYSA-N |
| SMILES | O=C(CCOCCOCCOCCOCCOCCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)Oc1c(F)c(F)c(F)c(F)c1F |
| 4,7,10,13,16,19,22-Heptaoxapentacosane-1,25-dioic acid, bis(2,3,4,5,6-pentafluorophenyl) ester |
| Bis(pentafluorophenyl) 4,7,10,13,16,19,22-heptaoxapentacosane-1,25-dioate |