Bis-PEG4-PFP ester structure
|
Common Name | Bis-PEG4-PFP ester | ||
|---|---|---|---|---|
| CAS Number | 1314378-12-5 | Molecular Weight | 626.395 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 570.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H20F10O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.7±25.0 °C | |
Use of Bis-PEG4-PFP esterBis-PEG4-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Bis-PEG4-PFP ester |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-PEG4-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 570.5±50.0 °C at 760 mmHg |
| Molecular Formula | C24H20F10O8 |
| Molecular Weight | 626.395 |
| Flash Point | 287.7±25.0 °C |
| Exact Mass | 626.099854 |
| LogP | 3.92 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | RCCGHSXHOCFIBV-UHFFFAOYSA-N |
| SMILES | O=C(CCOCCOCCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)Oc1c(F)c(F)c(F)c(F)c1F |
| Bis(pentafluorophenyl) 4,7,10,13-tetraoxahexadecane-1,16-dioate |
| MFCD21363293 |
| 4,7,10,13-Tetraoxahexadecane-1,16-dioic acid, bis(2,3,4,5,6-pentafluorophenyl) ester |